C13H20O4Si — CID 10659550
(1S,2R,3S,4R,7R)-3-methoxycarbonyl-7-trimethylsilylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 10659550) has the molecular formula C13H20O4Si and a molecular weight of 268.38 g/mol. Its IUPAC name is (1S,2R,3S,4R,7R)-3-methoxycarbonyl-7-trimethylsilylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4R,7R)-3-methoxycarbonyl-7-trimethylsilylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10659550 |
| Molecular Formula | C13H20O4Si |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (1S,2R,3S,4R,7R)-3-methoxycarbonyl-7-trimethylsilylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COC(=O)[C@@H]1[C@H]2C=C[C@@H]([C@@H]1C(=O)O)[C@H]2[Si](C)(C)C |
| InChI | InChI=1S/C13H20O4Si/c1-17-13(16)10-8-6-5-7(9(10)12(14)15)11(8)18(2,3)4/h5-11H,1-4H3,(H,14,15)/t7-,8+,9-,10+,11+/m0/s1 |
| InChIKey | HXNWMYXEYBYSPZ-OGBGREFGSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|