C16H20O4 — CID 98555112
dimethyl (1S,2R,5S,6S,7S,8R)-3,4-dimethyltricyclo[4.2.2.02,5]deca-3,9-diene-7,8-dicarboxylate (PubChem CID 98555112) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is dimethyl (1S,2R,5S,6S,7S,8R)-3,4-dimethyltricyclo[4.2.2.02,5]deca-3,9-diene-7,8-dicarboxylate.
| Compound Name | dimethyl (1S,2R,5S,6S,7S,8R)-3,4-dimethyltricyclo[4.2.2.02,5]deca-3,9-diene-7,8-dicarboxylate |
|---|---|
| PubChem CID | 98555112 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | dimethyl (1S,2R,5S,6S,7S,8R)-3,4-dimethyltricyclo[4.2.2.02,5]deca-3,9-diene-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C=C[C@H]([C@@H]1C(=O)OC)[C@@H]1C(C)=C(C)[C@H]21 |
| InChI | InChI=1S/C16H20O4/c1-7-8(2)12-10-6-5-9(11(7)12)13(15(17)19-3)14(10)16(18)20-4/h5-6,9-14H,1-4H3/t9-,10-,11-,12+,13-,14+/m0/s1 |
| InChIKey | KNMGUPAWWMJYRE-ARFNZGECSA-N |
| XLogP | 1.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|