C16H20O9S — CID 10715298
dimethyl (1S,2R,5S,6R,7R,8S)-3-ethoxysulfonyloxy-4-oxotricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate (PubChem CID 10715298) has the molecular formula C16H20O9S and a molecular weight of 388.39 g/mol. Its IUPAC name is dimethyl (1S,2R,5S,6R,7R,8S)-3-ethoxysulfonyloxy-4-oxotricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate.
| Compound Name | dimethyl (1S,2R,5S,6R,7R,8S)-3-ethoxysulfonyloxy-4-oxotricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate |
|---|---|
| PubChem CID | 10715298 |
| Molecular Formula | C16H20O9S |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | dimethyl (1S,2R,5S,6R,7R,8S)-3-ethoxysulfonyloxy-4-oxotricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate |
| SMILES | CCOS(=O)(=O)OC1C(=O)[C@H]2[C@H]3C=C[C@H]([C@H](C(=O)OC)[C@@H]3C(=O)OC)[C@@H]12 |
| InChI | InChI=1S/C16H20O9S/c1-4-24-26(20,21)25-14-10-8-6-5-7(9(10)13(14)17)11(15(18)22-2)12(8)16(19)23-3/h5-12,14H,4H2,1-3H3/t7-,8+,9+,10-,11-,12+,14?/m1/s1 |
| InChIKey | KEFPWXCOFJQAHW-SSZLMBMESA-N |
| XLogP | -0.14 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|