C14H16Br2O4 — CID 124922552
dimethyl (1R,2S,3R,4S,5S,6S,7S,8R)-3,4-dibromotricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate (PubChem CID 124922552) has the molecular formula C14H16Br2O4 and a molecular weight of 408.09 g/mol. Its IUPAC name is dimethyl (1R,2S,3R,4S,5S,6S,7S,8R)-3,4-dibromotricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3R,4S,5S,6S,7S,8R)-3,4-dibromotricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate |
|---|---|
| PubChem CID | 124922552 |
| Molecular Formula | C14H16Br2O4 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | dimethyl (1R,2S,3R,4S,5S,6S,7S,8R)-3,4-dibromotricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C=C[C@@H]([C@@H]1C(=O)OC)[C@@H]1[C@H](Br)[C@H](Br)[C@@H]21 |
| InChI | InChI=1S/C14H16Br2O4/c1-19-13(17)9-5-3-4-6(10(9)14(18)20-2)8-7(5)11(15)12(8)16/h3-12H,1-2H3/t5-,6+,7-,8-,9+,10-,11+,12-/m0/s1 |
| InChIKey | ORAZXYAVSPPWHK-MACVEKMSSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|