C10H12Br2O5 — CID 98524027
dimethyl (1R,2S,3R,4R,5R,6S)-5,6-dibromo-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 98524027) has the molecular formula C10H12Br2O5 and a molecular weight of 372.01 g/mol. Its IUPAC name is dimethyl (1R,2S,3R,4R,5R,6S)-5,6-dibromo-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3R,4R,5R,6S)-5,6-dibromo-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 98524027 |
| Molecular Formula | C10H12Br2O5 |
| Molecular Weight | 372.01 g/mol |
| Exact Mass | 369.91 |
| IUPAC Name | dimethyl (1R,2S,3R,4R,5R,6S)-5,6-dibromo-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2O[C@@H]([C@@H](Br)[C@H]2Br)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C10H12Br2O5/c1-15-9(13)3-4(10(14)16-2)8-6(12)5(11)7(3)17-8/h3-8H,1-2H3/t3-,4+,5+,6-,7-,8-/m1/s1 |
| InChIKey | YCJUEHAUUDTAAS-WNBCZPBOSA-N |
| XLogP | 0.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.01 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|