C10H14Cl2O4 — CID 11265664
dimethyl (1S,2R,3R,4R)-3,4-bis(chloromethyl)cyclobutane-1,2-dicarboxylate (PubChem CID 11265664) has the molecular formula C10H14Cl2O4 and a molecular weight of 269.12 g/mol. Its IUPAC name is dimethyl (1S,2R,3R,4R)-3,4-bis(chloromethyl)cyclobutane-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3R,4R)-3,4-bis(chloromethyl)cyclobutane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11265664 |
| Molecular Formula | C10H14Cl2O4 |
| Molecular Weight | 269.12 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | dimethyl (1S,2R,3R,4R)-3,4-bis(chloromethyl)cyclobutane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](CCl)[C@H](CCl)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C10H14Cl2O4/c1-15-9(13)7-5(3-11)6(4-12)8(7)10(14)16-2/h5-8H,3-4H2,1-2H3/t5-,6-,7-,8+/m0/s1 |
| InChIKey | WWRBIWFKAUTWEY-DKXJUACHSA-N |
| XLogP | 1.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|