C10H13ClO3 — CID 131123004
methyl (1R,2S,3S,4R)-3-(chloromethyl)-6-oxobicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 131123004) has the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. Its IUPAC name is methyl (1R,2S,3S,4R)-3-(chloromethyl)-6-oxobicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1R,2S,3S,4R)-3-(chloromethyl)-6-oxobicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 131123004 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | methyl (1R,2S,3S,4R)-3-(chloromethyl)-6-oxobicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](CCl)[C@H]2CC(=O)[C@@H]1C2 |
| InChI | InChI=1S/C10H13ClO3/c1-14-10(13)9-6-2-5(3-8(6)12)7(9)4-11/h5-7,9H,2-4H2,1H3/t5-,6+,7+,9+/m1/s1 |
| InChIKey | JJRWNABDPHGYJI-XKBZYTNZSA-N |
| XLogP | 1.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|