C15H16Cl4O4 — CID 124837043
dimethyl (1R,2R,3S,4S,5R,6R,7S,8R)-3-chloro-4-(trichloromethyl)tricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate (PubChem CID 124837043) has the molecular formula C15H16Cl4O4 and a molecular weight of 402.10 g/mol. Its IUPAC name is dimethyl (1R,2R,3S,4S,5R,6R,7S,8R)-3-chloro-4-(trichloromethyl)tricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3S,4S,5R,6R,7S,8R)-3-chloro-4-(trichloromethyl)tricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate |
|---|---|
| PubChem CID | 124837043 |
| Molecular Formula | C15H16Cl4O4 |
| Molecular Weight | 402.10 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | dimethyl (1R,2R,3S,4S,5R,6R,7S,8R)-3-chloro-4-(trichloromethyl)tricyclo[4.2.2.02,5]dec-9-ene-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C=C[C@@H]([C@@H]1C(=O)OC)[C@@H]1[C@@H]2[C@H](Cl)[C@H]1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H16Cl4O4/c1-22-13(20)9-5-3-4-6(10(9)14(21)23-2)8-7(5)11(12(8)16)15(17,18)19/h3-12H,1-2H3/t5-,6+,7-,8-,9+,10-,11+,12+/m1/s1 |
| InChIKey | ZHFQQVKDSXTXHT-DRELSCCUSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|