C20H28O8 — CID 12580813
tetraethyl bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylate (PubChem CID 12580813) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is tetraethyl bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylate.
| Compound Name | tetraethyl bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 12580813 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | tetraethyl bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylate |
| SMILES | CCOC(=O)C1C2C=CC(C1C(=O)OCC)C(C(=O)OCC)C2C(=O)OCC |
| InChI | InChI=1S/C20H28O8/c1-5-25-17(21)13-11-9-10-12(14(13)18(22)26-6-2)16(20(24)28-8-4)15(11)19(23)27-7-3/h9-16H,5-8H2,1-4H3 |
| InChIKey | YIJKWGOBWTWJET-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|