C11H16O3 — CID 118520826
ethyl 3-hydroxybicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 118520826) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is ethyl 3-hydroxybicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | ethyl 3-hydroxybicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 118520826 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | ethyl 3-hydroxybicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | CCOC(=O)C1C2C=CC(CC2)C1O |
| InChI | InChI=1S/C11H16O3/c1-2-14-11(13)9-7-3-5-8(6-4-7)10(9)12/h3,5,7-10,12H,2,4,6H2,1H3 |
| InChIKey | NFQGJSJIIRJUCO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|