C11H18O3 — CID 146555568
ethyl (3S)-3-hydroxybicyclo[2.2.2]octane-2-carboxylate (PubChem CID 146555568) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is ethyl (3S)-3-hydroxybicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | ethyl (3S)-3-hydroxybicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 146555568 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | ethyl (3S)-3-hydroxybicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CCOC(=O)C1C2CCC(CC2)[C@@H]1O |
| InChI | InChI=1S/C11H18O3/c1-2-14-11(13)9-7-3-5-8(6-4-7)10(9)12/h7-10,12H,2-6H2,1H3/t7?,8?,9?,10-/m0/s1 |
| InChIKey | SQUJEWKLUBBNGJ-VVIYDGDNSA-N |
| XLogP | 1.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |