C11H19ClO3 — CID 139623994
methyl (1R,2R,3R,5R)-5-(2-chloropropan-2-yl)-3-hydroxy-2-methylcyclopentane-1-carboxylate (PubChem CID 139623994) has the molecular formula C11H19ClO3 and a molecular weight of 234.72 g/mol. Its IUPAC name is methyl (1R,2R,3R,5R)-5-(2-chloropropan-2-yl)-3-hydroxy-2-methylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,3R,5R)-5-(2-chloropropan-2-yl)-3-hydroxy-2-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 139623994 |
| Molecular Formula | C11H19ClO3 |
| Molecular Weight | 234.72 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | methyl (1R,2R,3R,5R)-5-(2-chloropropan-2-yl)-3-hydroxy-2-methylcyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C)[C@H](O)C[C@H]1C(C)(C)Cl |
| InChI | InChI=1S/C11H19ClO3/c1-6-8(13)5-7(11(2,3)12)9(6)10(14)15-4/h6-9,13H,5H2,1-4H3/t6-,7+,8+,9+/m0/s1 |
| InChIKey | VGKHJMLCNQTTIZ-JQCXWYLXSA-N |
| XLogP | 1.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.72 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|