C12H18O4 — CID 159731557
dimethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate;methane (PubChem CID 159731557) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is dimethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate;methane.
| Compound Name | dimethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate;methane |
|---|---|
| PubChem CID | 159731557 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | dimethyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate;methane |
| SMILES | C.COC(=O)C1C2C=CC(C2)C1C(=O)OC |
| InChI | InChI=1S/C11H14O4.CH4/c1-14-10(12)8-6-3-4-7(5-6)9(8)11(13)15-2;/h3-4,6-9H,5H2,1-2H3;1H4 |
| InChIKey | NBHJPBRGZHBOAN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|