C10H11O4- — CID 11892964
(1R,2S,3R,4S)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11892964) has the molecular formula C10H11O4- and a molecular weight of 195.19 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3R,4S)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11892964 |
| Molecular Formula | C10H11O4- |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (1R,2S,3R,4S)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](C(=O)[O-])[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C10H12O4/c1-14-10(13)8-6-3-2-5(4-6)7(8)9(11)12/h2-3,5-8H,4H2,1H3,(H,11,12)/p-1/t5-,6+,7-,8+/m0/s1 |
| InChIKey | JYZKYCYHXBQTCY-FKSUSPILSA-M |
| XLogP | -0.65 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|