C12H15O7S- — CID 58520265
2-(3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carbonyl)oxyethanesulfonate (PubChem CID 58520265) has the molecular formula C12H15O7S- and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-(3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carbonyl)oxyethanesulfonate.
| Compound Name | 2-(3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carbonyl)oxyethanesulfonate |
|---|---|
| PubChem CID | 58520265 |
| Molecular Formula | C12H15O7S- |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-(3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carbonyl)oxyethanesulfonate |
| SMILES | COC(=O)C1C2C=CC(C2)C1C(=O)OCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H16O7S/c1-18-11(13)9-7-2-3-8(6-7)10(9)12(14)19-4-5-20(15,16)17/h2-3,7-10H,4-6H2,1H3,(H,15,16,17)/p-1 |
| InChIKey | YMARLSJOVWOMQX-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|