C10H13O5S- — CID 140586122
2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethanesulfonate (PubChem CID 140586122) has the molecular formula C10H13O5S- and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethanesulfonate.
| Compound Name | 2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethanesulfonate |
|---|---|
| PubChem CID | 140586122 |
| Molecular Formula | C10H13O5S- |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethanesulfonate |
| SMILES | O=C(OCCS(=O)(=O)[O-])C1CC2C=CC1C2 |
| InChI | InChI=1S/C10H14O5S/c11-10(15-3-4-16(12,13)14)9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2,(H,12,13,14)/p-1 |
| InChIKey | OKISDQMXHZDOPP-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|