C45H60O12 — CID 121399474
2-[3-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]-2,2-bis[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxymethyl]propoxy]ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 121399474) has the molecular formula C45H60O12 and a molecular weight of 792.96 g/mol. Its IUPAC name is 2-[3-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]-2,2-bis[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxymethyl]propoxy]ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2-[3-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]-2,2-bis[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxymethyl]propoxy]ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 121399474 |
| Molecular Formula | C45H60O12 |
| Molecular Weight | 792.96 g/mol |
| Exact Mass | 792.41 |
| IUPAC Name | 2-[3-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]-2,2-bis[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxymethyl]propoxy]ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCCOCC(COCCOC(=O)C1CC2C=CC1C2)(COCCOC(=O)C1CC2C=CC1C2)COCCOC(=O)C1CC2C=CC1C2)C1CC2C=CC1C2 |
| InChI | InChI=1S/C45H60O12/c46-41(37-21-29-1-5-33(37)17-29)54-13-9-50-25-45(26-51-10-14-55-42(47)38-22-30-2-6-34(38)18-30,27-52-11-15-56-43(48)39-23-31-3-7-35(39)19-31)28-53-12-16-57-44(49)40-24-32-4-8-36(40)20-32/h1-8,29-40H,9-28H2 |
| InChIKey | JKFZUPSJLAQYGD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|