C14H22O5 — CID 174980269
[4-hydroxy-3,3-bis(hydroxymethyl)butyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 174980269) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is [4-hydroxy-3,3-bis(hydroxymethyl)butyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [4-hydroxy-3,3-bis(hydroxymethyl)butyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 174980269 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [4-hydroxy-3,3-bis(hydroxymethyl)butyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCCC(CO)(CO)CO)C1CC2C=CC1C2 |
| InChI | InChI=1S/C14H22O5/c15-7-14(8-16,9-17)3-4-19-13(18)12-6-10-1-2-11(12)5-10/h1-2,10-12,15-17H,3-9H2 |
| InChIKey | RBRCHCAXFXOJFG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|