C14H14F6O5 — CID 20826487
2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 20826487) has the molecular formula C14H14F6O5 and a molecular weight of 376.25 g/mol. Its IUPAC name is 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 20826487 |
| Molecular Formula | C14H14F6O5 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C14H14F6O5/c15-13(16,17)12(23,14(18,19)20)11(22)25-4-3-24-10(21)9-6-7-1-2-8(9)5-7/h1-2,7-9,23H,3-6H2 |
| InChIKey | OHVMLYHFKNZMSX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|