C14H19F3O3 — CID 59000332
(5,5,5-trifluoro-4-hydroxy-4-methylpentyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 59000332) has the molecular formula C14H19F3O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is (5,5,5-trifluoro-4-hydroxy-4-methylpentyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (5,5,5-trifluoro-4-hydroxy-4-methylpentyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 59000332 |
| Molecular Formula | C14H19F3O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (5,5,5-trifluoro-4-hydroxy-4-methylpentyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(O)(CCCOC(=O)C1CC2C=CC1C2)C(F)(F)F |
| InChI | InChI=1S/C14H19F3O3/c1-13(19,14(15,16)17)5-2-6-20-12(18)11-8-9-3-4-10(11)7-9/h3-4,9-11,19H,2,5-8H2,1H3 |
| InChIKey | SYQVAFUWCWUHRO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|