C14H18O6 — CID 71169619
4-[2-[(4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]oxyethoxy]-4-oxobutanoic acid (PubChem CID 71169619) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4-[2-[(4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]oxyethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[(4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]oxyethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71169619 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-[2-[(4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]oxyethoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OCCOC(=O)C1C[C@H]2C=CC1C2 |
| InChI | InChI=1S/C14H18O6/c15-12(16)3-4-13(17)19-5-6-20-14(18)11-8-9-1-2-10(11)7-9/h1-2,9-11H,3-8H2,(H,15,16)/t9-,10?,11?/m0/s1 |
| InChIKey | FWJBNHFYBJVZJY-WHXUTIOJSA-N |
| XLogP | 1.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|