C30H51NO12 — CID 11262060
2-[bis[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-oxopropyl]amino]ethyl (1R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11262060) has the molecular formula C30H51NO12 and a molecular weight of 617.73 g/mol. Its IUPAC name is 2-[bis[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-oxopropyl]amino]ethyl (1R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2-[bis[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-oxopropyl]amino]ethyl (1R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11262060 |
| Molecular Formula | C30H51NO12 |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.34 |
| IUPAC Name | 2-[bis[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-oxopropyl]amino]ethyl (1R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COCCOCCOCCOC(=O)CCN(CCOC(=O)C1C[C@@H]2C=C[C@H]1C2)CCC(=O)OCCOCCOCCOC |
| InChI | InChI=1S/C30H51NO12/c1-35-11-13-37-15-17-39-19-21-41-28(32)5-7-31(9-10-43-30(34)27-24-25-3-4-26(27)23-25)8-6-29(33)42-22-20-40-18-16-38-14-12-36-2/h3-4,25-27H,5-24H2,1-2H3/t25-,26+,27?/m1/s1 |
| InChIKey | NTZQMGVFCPGWCE-JZGSEIKYSA-N |
| XLogP | 1.27 |
| TPSA | 137.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|