C10H21NO7 — CID 161393191
2-methoxyethyl 3-[bis(2-hydroperoxyethyl)amino]propanoate (PubChem CID 161393191) has the molecular formula C10H21NO7 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-methoxyethyl 3-[bis(2-hydroperoxyethyl)amino]propanoate.
| Compound Name | 2-methoxyethyl 3-[bis(2-hydroperoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 161393191 |
| Molecular Formula | C10H21NO7 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-methoxyethyl 3-[bis(2-hydroperoxyethyl)amino]propanoate |
| SMILES | COCCOC(=O)CCN(CCOO)CCOO |
| InChI | InChI=1S/C10H21NO7/c1-15-8-9-16-10(12)2-3-11(4-6-17-13)5-7-18-14/h13-14H,2-9H2,1H3 |
| InChIKey | VTGKDZHBVOHUNV-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|