C15H30N2O6 — CID 169151963
2-methoxyethyl 3-[[3-(2-methoxyethoxy)-3-oxopropyl]-[2-(methylamino)ethyl]amino]propanoate (PubChem CID 169151963) has the molecular formula C15H30N2O6 and a molecular weight of 334.41 g/mol. Its IUPAC name is 2-methoxyethyl 3-[[3-(2-methoxyethoxy)-3-oxopropyl]-[2-(methylamino)ethyl]amino]propanoate.
| Compound Name | 2-methoxyethyl 3-[[3-(2-methoxyethoxy)-3-oxopropyl]-[2-(methylamino)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 169151963 |
| Molecular Formula | C15H30N2O6 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-methoxyethyl 3-[[3-(2-methoxyethoxy)-3-oxopropyl]-[2-(methylamino)ethyl]amino]propanoate |
| SMILES | CNCCN(CCC(=O)OCCOC)CCC(=O)OCCOC |
| InChI | InChI=1S/C15H30N2O6/c1-16-6-9-17(7-4-14(18)22-12-10-20-2)8-5-15(19)23-13-11-21-3/h16H,4-13H2,1-3H3 |
| InChIKey | ADMSDQVYVWEKBX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|