C35H66N2O11 — CID 176880609
butyl 3-[5-hydroxypentyl-[3-[6-[3-[5-hydroxypentyl-[3-(2-methoxyethoxy)-3-oxopropyl]amino]propanoyloxy]hexoxy]-3-oxopropyl]amino]propanoate (PubChem CID 176880609) has the molecular formula C35H66N2O11 and a molecular weight of 690.92 g/mol. Its IUPAC name is butyl 3-[5-hydroxypentyl-[3-[6-[3-[5-hydroxypentyl-[3-(2-methoxyethoxy)-3-oxopropyl]amino]propanoyloxy]hexoxy]-3-oxopropyl]amino]propanoate.
| Compound Name | butyl 3-[5-hydroxypentyl-[3-[6-[3-[5-hydroxypentyl-[3-(2-methoxyethoxy)-3-oxopropyl]amino]propanoyloxy]hexoxy]-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 176880609 |
| Molecular Formula | C35H66N2O11 |
| Molecular Weight | 690.92 g/mol |
| Exact Mass | 690.47 |
| IUPAC Name | butyl 3-[5-hydroxypentyl-[3-[6-[3-[5-hydroxypentyl-[3-(2-methoxyethoxy)-3-oxopropyl]amino]propanoyloxy]hexoxy]-3-oxopropyl]amino]propanoate |
| SMILES | CCCCOC(=O)CCN(CCCCCO)CCC(=O)OCCCCCCOC(=O)CCN(CCCCCO)CCC(=O)OCCOC |
| InChI | InChI=1S/C35H66N2O11/c1-3-4-27-45-32(40)15-21-36(19-9-7-11-25-38)22-16-33(41)46-28-13-5-6-14-29-47-34(42)17-23-37(20-10-8-12-26-39)24-18-35(43)48-31-30-44-2/h38-39H,3-31H2,1-2H3 |
| InChIKey | GOPSGNMBKXYNFA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 161.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.92 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|