C18H37NO4 — CID 138538334
6-hydroxyhexyl 3-[4-hydroxybutyl(3-methylbutyl)amino]propanoate (PubChem CID 138538334) has the molecular formula C18H37NO4 and a molecular weight of 331.50 g/mol. Its IUPAC name is 6-hydroxyhexyl 3-[4-hydroxybutyl(3-methylbutyl)amino]propanoate.
| Compound Name | 6-hydroxyhexyl 3-[4-hydroxybutyl(3-methylbutyl)amino]propanoate |
|---|---|
| PubChem CID | 138538334 |
| Molecular Formula | C18H37NO4 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 6-hydroxyhexyl 3-[4-hydroxybutyl(3-methylbutyl)amino]propanoate |
| SMILES | CC(C)CCN(CCCCO)CCC(=O)OCCCCCCO |
| InChI | InChI=1S/C18H37NO4/c1-17(2)9-12-19(11-5-7-15-21)13-10-18(22)23-16-8-4-3-6-14-20/h17,20-21H,3-16H2,1-2H3 |
| InChIKey | KUVPHUDZFQOKLV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|