About 6-hydroxyhexyl 4-methylpentanoate
6-hydroxyhexyl 4-methylpentanoate (PubChem CID 87401580) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is 6-hydroxyhexyl 4-methylpentanoate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl 4-methylpentanoate |
| PubChem CID | 87401580 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 6-hydroxyhexyl 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)OCCCCCCO |
| InChI | InChI=1S/C12H24O3/c1-11(2)7-8-12(14)15-10-6-4-3-5-9-13/h11,13H,3-10H2,1-2H3 |
| InChIKey | LMGLQAPXHUMDQQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl 4-methylpentanoate?
The IUPAC name of 6-hydroxyhexyl 4-methylpentanoate (CID 87401580) is 6-hydroxyhexyl 4-methylpentanoate.
What is the SMILES notation for 6-hydroxyhexyl 4-methylpentanoate?
The canonical SMILES for 6-hydroxyhexyl 4-methylpentanoate is CC(C)CCC(=O)OCCCCCCO.
What is the InChIKey of 6-hydroxyhexyl 4-methylpentanoate?
The InChIKey is LMGLQAPXHUMDQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-11(2)7-8-12(14)15-10-6-4-3-5-9-13/h11,13H,3-10H2,1-2H3.
What are the key properties of 6-hydroxyhexyl 4-methylpentanoate?
6-hydroxyhexyl 4-methylpentanoate has a molecular weight of 216.32 g/mol, XLogP of 2.52, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl 4-methylpentanoate is sourced from PubChem (CID 87401580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).