C21H39NO6 — CID 59204058
butyl 3-[bis(3-butoxy-3-oxopropyl)amino]propanoate (PubChem CID 59204058) has the molecular formula C21H39NO6 and a molecular weight of 401.54 g/mol. Its IUPAC name is butyl 3-[bis(3-butoxy-3-oxopropyl)amino]propanoate.
| Compound Name | butyl 3-[bis(3-butoxy-3-oxopropyl)amino]propanoate |
|---|---|
| PubChem CID | 59204058 |
| Molecular Formula | C21H39NO6 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | butyl 3-[bis(3-butoxy-3-oxopropyl)amino]propanoate |
| SMILES | CCCCOC(=O)CCN(CCC(=O)OCCCC)CCC(=O)OCCCC |
| InChI | InChI=1S/C21H39NO6/c1-4-7-16-26-19(23)10-13-22(14-11-20(24)27-17-8-5-2)15-12-21(25)28-18-9-6-3/h4-18H2,1-3H3 |
| InChIKey | ISCOOJXNULVOPU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|