C16H31NO4 — CID 58040528
propyl 3-[butyl-(3-oxo-3-propoxypropyl)amino]propanoate (PubChem CID 58040528) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is propyl 3-[butyl-(3-oxo-3-propoxypropyl)amino]propanoate.
| Compound Name | propyl 3-[butyl-(3-oxo-3-propoxypropyl)amino]propanoate |
|---|---|
| PubChem CID | 58040528 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | propyl 3-[butyl-(3-oxo-3-propoxypropyl)amino]propanoate |
| SMILES | CCCCN(CCC(=O)OCCC)CCC(=O)OCCC |
| InChI | InChI=1S/C16H31NO4/c1-4-7-10-17(11-8-15(18)20-13-5-2)12-9-16(19)21-14-6-3/h4-14H2,1-3H3 |
| InChIKey | JLTXEGMPUVSVTD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |