C19H37NO5S — CID 165003528
propyl 3-[3-butylsulfanylpropyl-[3-(2-methoxyethoxy)-3-oxopropyl]amino]propanoate (PubChem CID 165003528) has the molecular formula C19H37NO5S and a molecular weight of 391.57 g/mol. Its IUPAC name is propyl 3-[3-butylsulfanylpropyl-[3-(2-methoxyethoxy)-3-oxopropyl]amino]propanoate.
| Compound Name | propyl 3-[3-butylsulfanylpropyl-[3-(2-methoxyethoxy)-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 165003528 |
| Molecular Formula | C19H37NO5S |
| Molecular Weight | 391.57 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | propyl 3-[3-butylsulfanylpropyl-[3-(2-methoxyethoxy)-3-oxopropyl]amino]propanoate |
| SMILES | CCCCSCCCN(CCC(=O)OCCC)CCC(=O)OCCOC |
| InChI | InChI=1S/C19H37NO5S/c1-4-6-16-26-17-7-10-20(11-8-18(21)24-13-5-2)12-9-19(22)25-15-14-23-3/h4-17H2,1-3H3 |
| InChIKey | CHCUJRLIRRXEGI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|