C46H83N3O8 — CID 174252420
propyl 3-[3-[3-[bis[3-[(Z)-oct-3-enoxy]-3-oxopropyl]amino]propyl-methylamino]propyl-[3-[(Z)-oct-3-enoxy]-3-oxopropyl]amino]propanoate (PubChem CID 174252420) has the molecular formula C46H83N3O8 and a molecular weight of 806.18 g/mol. Its IUPAC name is propyl 3-[3-[3-[bis[3-[(Z)-oct-3-enoxy]-3-oxopropyl]amino]propyl-methylamino]propyl-[3-[(Z)-oct-3-enoxy]-3-oxopropyl]amino]propanoate.
| Compound Name | propyl 3-[3-[3-[bis[3-[(Z)-oct-3-enoxy]-3-oxopropyl]amino]propyl-methylamino]propyl-[3-[(Z)-oct-3-enoxy]-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 174252420 |
| Molecular Formula | C46H83N3O8 |
| Molecular Weight | 806.18 g/mol |
| Exact Mass | 805.62 |
| IUPAC Name | propyl 3-[3-[3-[bis[3-[(Z)-oct-3-enoxy]-3-oxopropyl]amino]propyl-methylamino]propyl-[3-[(Z)-oct-3-enoxy]-3-oxopropyl]amino]propanoate |
| SMILES | CCCC/C=C\CCOC(=O)CCN(CCCN(C)CCCN(CCC(=O)OCC/C=C\CCCC)CCC(=O)OCC/C=C\CCCC)CCC(=O)OCCC |
| InChI | InChI=1S/C46H83N3O8/c1-6-10-13-16-19-22-40-55-44(51)28-36-48(35-27-43(50)54-39-9-4)33-25-31-47(5)32-26-34-49(37-29-45(52)56-41-23-20-17-14-11-7-2)38-30-46(53)57-42-24-21-18-15-12-8-3/h16-21H,6-15,22-42H2,1-5H3/b19-16-,20-17-,21-18- |
| InChIKey | FUDLEVLHOUESJC-JFJOQQEJSA-N |
| XLogP | 8.86 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.18 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|