C16H32N2O4S2 — CID 163985834
2-(2-propanoyloxyethyldisulfanyl)ethyl 3-[2-(methylamino)ethyl-propylamino]propanoate (PubChem CID 163985834) has the molecular formula C16H32N2O4S2 and a molecular weight of 380.58 g/mol. Its IUPAC name is 2-(2-propanoyloxyethyldisulfanyl)ethyl 3-[2-(methylamino)ethyl-propylamino]propanoate.
| Compound Name | 2-(2-propanoyloxyethyldisulfanyl)ethyl 3-[2-(methylamino)ethyl-propylamino]propanoate |
|---|---|
| PubChem CID | 163985834 |
| Molecular Formula | C16H32N2O4S2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-(2-propanoyloxyethyldisulfanyl)ethyl 3-[2-(methylamino)ethyl-propylamino]propanoate |
| SMILES | CCCN(CCNC)CCC(=O)OCCSSCCOC(=O)CC |
| InChI | InChI=1S/C16H32N2O4S2/c1-4-8-18(10-7-17-3)9-6-16(20)22-12-14-24-23-13-11-21-15(19)5-2/h17H,4-14H2,1-3H3 |
| InChIKey | TWFRUKCMNHCOET-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|