C41H72N2O16 — CID 156821481
2-(2-methoxyethoxy)ethyl 3-[6-[bis[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]hexyl-[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]propanoate (PubChem CID 156821481) has the molecular formula C41H72N2O16 and a molecular weight of 849.02 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 3-[6-[bis[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]hexyl-[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]propanoate.
| Compound Name | 2-(2-methoxyethoxy)ethyl 3-[6-[bis[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]hexyl-[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 156821481 |
| Molecular Formula | C41H72N2O16 |
| Molecular Weight | 849.02 g/mol |
| Exact Mass | 848.49 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 3-[6-[bis[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]hexyl-[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]propanoate |
| SMILES | C=COCCOCCOC(=O)CCN(CCCCCCN(CCC(=O)OCCOCCOC=C)CCC(=O)OCCOCCOC=C)CCC(=O)OCCOCCOC |
| InChI | InChI=1S/C41H72N2O16/c1-5-49-24-27-53-31-35-57-39(45)13-19-42(18-12-38(44)56-34-30-52-23-22-48-4)16-10-8-9-11-17-43(20-14-40(46)58-36-32-54-28-25-50-6-2)21-15-41(47)59-37-33-55-29-26-51-7-3/h5-7H,1-3,8-37H2,4H3 |
| InChIKey | DRQACFWDAQXBBJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 185.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.02 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|