C34H60N2O15 — CID 156821479
ethyl 3-[2-[2-[2-[bis[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]ethoxy]ethoxy]ethyl-[3-(2-hydroxyethoxy)-3-oxopropyl]amino]propanoate (PubChem CID 156821479) has the molecular formula C34H60N2O15 and a molecular weight of 736.85 g/mol. Its IUPAC name is ethyl 3-[2-[2-[2-[bis[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]ethoxy]ethoxy]ethyl-[3-(2-hydroxyethoxy)-3-oxopropyl]amino]propanoate.
| Compound Name | ethyl 3-[2-[2-[2-[bis[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]ethoxy]ethoxy]ethyl-[3-(2-hydroxyethoxy)-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 156821479 |
| Molecular Formula | C34H60N2O15 |
| Molecular Weight | 736.85 g/mol |
| Exact Mass | 736.40 |
| IUPAC Name | ethyl 3-[2-[2-[2-[bis[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropyl]amino]ethoxy]ethoxy]ethyl-[3-(2-hydroxyethoxy)-3-oxopropyl]amino]propanoate |
| SMILES | C=COCCOCCOC(=O)CCN(CCOCCOCCN(CCC(=O)OCC)CCC(=O)OCCO)CCC(=O)OCCOCCOC=C |
| InChI | InChI=1S/C34H60N2O15/c1-4-42-21-23-46-27-29-50-33(40)9-13-36(14-10-34(41)51-30-28-47-24-22-43-5-2)16-19-45-26-25-44-18-15-35(11-7-31(38)48-6-3)12-8-32(39)49-20-17-37/h4-5,37H,1-2,6-30H2,3H3 |
| InChIKey | XJMVOKAWKQKWBO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 187.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.85 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|