About 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate
2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate (PubChem CID 20770081) has the molecular formula C14H24O8
and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate.
Molecular Properties
| Compound Name | 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate |
| PubChem CID | 20770081 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate |
| SMILES | C=COCOCCOC(=O)CCOCOCCOC(=O)CC |
| InChI | InChI=1S/C14H24O8/c1-3-13(15)21-9-7-20-12-18-6-5-14(16)22-10-8-19-11-17-4-2/h4H,2-3,5-12H2,1H3 |
| InChIKey | IEXXWTLHVXAAOL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate?
The IUPAC name of 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate (CID 20770081) is 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate.
What is the SMILES notation for 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate?
The canonical SMILES for 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate is C=COCOCCOC(=O)CCOCOCCOC(=O)CC.
What is the InChIKey of 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate?
The InChIKey is IEXXWTLHVXAAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O8/c1-3-13(15)21-9-7-20-12-18-6-5-14(16)22-10-8-19-11-17-4-2/h4H,2-3,5-12H2,1H3.
What are the key properties of 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate?
2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate has a molecular weight of 320.34 g/mol, XLogP of 1.00, 15 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethenoxymethoxy)ethyl 3-(2-propanoyloxyethoxymethoxy)propanoate is sourced from PubChem (CID 20770081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).