About 2-chloroethyl 3-propanoyloxypropanoate
2-chloroethyl 3-propanoyloxypropanoate (PubChem CID 173277422) has the molecular formula C8H13ClO4
and a molecular weight of 208.64 g/mol. Its IUPAC name is 2-chloroethyl 3-propanoyloxypropanoate.
Molecular Properties
| Compound Name | 2-chloroethyl 3-propanoyloxypropanoate |
| PubChem CID | 173277422 |
| Molecular Formula | C8H13ClO4 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-chloroethyl 3-propanoyloxypropanoate |
| SMILES | CCC(=O)OCCC(=O)OCCCl |
| InChI | InChI=1S/C8H13ClO4/c1-2-7(10)12-5-3-8(11)13-6-4-9/h2-6H2,1H3 |
| InChIKey | JEYPOCPPHOPMKZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl 3-propanoyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl 3-propanoyloxypropanoate?
The IUPAC name of 2-chloroethyl 3-propanoyloxypropanoate (CID 173277422) is 2-chloroethyl 3-propanoyloxypropanoate.
What is the SMILES notation for 2-chloroethyl 3-propanoyloxypropanoate?
The canonical SMILES for 2-chloroethyl 3-propanoyloxypropanoate is CCC(=O)OCCC(=O)OCCCl.
What is the InChIKey of 2-chloroethyl 3-propanoyloxypropanoate?
The InChIKey is JEYPOCPPHOPMKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO4/c1-2-7(10)12-5-3-8(11)13-6-4-9/h2-6H2,1H3.
What are the key properties of 2-chloroethyl 3-propanoyloxypropanoate?
2-chloroethyl 3-propanoyloxypropanoate has a molecular weight of 208.64 g/mol, XLogP of 1.11, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl 3-propanoyloxypropanoate is sourced from PubChem (CID 173277422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).