About methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate
methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate (PubChem CID 160585097) has the molecular formula C14H24O7
and a molecular weight of 304.34 g/mol. Its IUPAC name is methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate.
Molecular Properties
| Compound Name | methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate |
| PubChem CID | 160585097 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate |
| SMILES | CCC(=O)OCCC(=O)OC.CCC(=O)OCCC(C)=O |
| InChI | InChI=1S/C7H12O4.C7H12O3/c1-3-6(8)11-5-4-7(9)10-2;1-3-7(9)10-5-4-6(2)8/h3-5H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | RCHHDABLRWQTAR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate?
The IUPAC name of methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate (CID 160585097) is methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate.
What is the SMILES notation for methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate?
The canonical SMILES for methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate is CCC(=O)OCCC(=O)OC.CCC(=O)OCCC(C)=O.
What is the InChIKey of methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate?
The InChIKey is RCHHDABLRWQTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4.C7H12O3/c1-3-6(8)11-5-4-7(9)10-2;1-3-7(9)10-5-4-6(2)8/h3-5H2,1-2H3;3-5H2,1-2H3.
What are the key properties of methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate?
methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate has a molecular weight of 304.34 g/mol, XLogP of 1.42, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-propanoyloxypropanoate;3-oxobutyl propanoate is sourced from PubChem (CID 160585097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).