C17H28N2O9 — CID 58882686
2-methoxyethyl 3-[2-[[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate (PubChem CID 58882686) has the molecular formula C17H28N2O9 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-methoxyethyl 3-[2-[[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate.
| Compound Name | 2-methoxyethyl 3-[2-[[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 58882686 |
| Molecular Formula | C17H28N2O9 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-methoxyethyl 3-[2-[[3-[2-(2-ethenoxyethoxy)ethoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate |
| SMILES | C=COCCOCCOC(=O)CC(=O)NCCNC(=O)CC(=O)OCCOC |
| InChI | InChI=1S/C17H28N2O9/c1-3-25-7-8-26-9-11-28-17(23)13-15(21)19-5-4-18-14(20)12-16(22)27-10-6-24-2/h3H,1,4-13H2,2H3,(H,18,20)(H,19,21) |
| InChIKey | CUCHEWUPZXWMMJ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|