About 2-ethenoxyethyl 3-oxobutanoate
2-ethenoxyethyl 3-oxobutanoate (PubChem CID 23370733) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-ethenoxyethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 2-ethenoxyethyl 3-oxobutanoate |
| PubChem CID | 23370733 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-ethenoxyethyl 3-oxobutanoate |
| SMILES | C=COCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C8H12O4/c1-3-11-4-5-12-8(10)6-7(2)9/h3H,1,4-6H2,2H3 |
| InChIKey | FVAKYJXOKAKNIA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenoxyethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenoxyethyl 3-oxobutanoate?
The IUPAC name of 2-ethenoxyethyl 3-oxobutanoate (CID 23370733) is 2-ethenoxyethyl 3-oxobutanoate.
What is the SMILES notation for 2-ethenoxyethyl 3-oxobutanoate?
The canonical SMILES for 2-ethenoxyethyl 3-oxobutanoate is C=COCCOC(=O)CC(C)=O.
What is the InChIKey of 2-ethenoxyethyl 3-oxobutanoate?
The InChIKey is FVAKYJXOKAKNIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-3-11-4-5-12-8(10)6-7(2)9/h3H,1,4-6H2,2H3.
What are the key properties of 2-ethenoxyethyl 3-oxobutanoate?
2-ethenoxyethyl 3-oxobutanoate has a molecular weight of 172.18 g/mol, XLogP of 0.67, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenoxyethyl 3-oxobutanoate is sourced from PubChem (CID 23370733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).