About methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate
methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate (PubChem CID 131728346) has the molecular formula C15H22O7
and a molecular weight of 314.33 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate |
| PubChem CID | 131728346 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C10H14O5.C5H8O2/c1-7(2)10(13)15-5-4-14-9(12)6-8(3)11;1-4(2)5(6)7-3/h1,4-6H2,2-3H3;1H2,2-3H3 |
| InChIKey | KVHQHTSHXHFDOL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
The IUPAC name of methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate (CID 131728346) is methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate.
What is the SMILES notation for methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
The canonical SMILES for methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate is C=C(C)C(=O)OC.C=C(C)C(=O)OCCOC(=O)CC(C)=O.
What is the InChIKey of methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
The InChIKey is KVHQHTSHXHFDOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5.C5H8O2/c1-7(2)10(13)15-5-4-14-9(12)6-8(3)11;1-4(2)5(6)7-3/h1,4-6H2,2-3H3;1H2,2-3H3.
What are the key properties of methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate has a molecular weight of 314.33 g/mol, XLogP of 1.36, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate is sourced from PubChem (CID 131728346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).