C20H31NO8 — CID 10047362
2-methoxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;(2-methylprop-2-enoylamino) 2-methylprop-2-enoate (PubChem CID 10047362) has the molecular formula C20H31NO8 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-methoxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;(2-methylprop-2-enoylamino) 2-methylprop-2-enoate.
| Compound Name | 2-methoxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;(2-methylprop-2-enoylamino) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 10047362 |
| Molecular Formula | C20H31NO8 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-methoxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;(2-methylprop-2-enoylamino) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)NOC(=O)C(=C)C.C=C(C)C(=O)OC.C=C(C)C(=O)OCCOC |
| InChI | InChI=1S/C8H11NO3.C7H12O3.C5H8O2/c1-5(2)7(10)9-12-8(11)6(3)4;1-6(2)7(8)10-5-4-9-3;1-4(2)5(6)7-3/h1,3H2,2,4H3,(H,9,10);1,4-5H2,2-3H3;1H2,2-3H3 |
| InChIKey | RYSCIXXKASRBFL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|