C22H36N2O9 — CID 158387580
methanamine;2-(2-methylprop-2-enoyloxy)ethyl (Z)-3-(methylamino)but-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate (PubChem CID 158387580) has the molecular formula C22H36N2O9 and a molecular weight of 472.54 g/mol. Its IUPAC name is methanamine;2-(2-methylprop-2-enoyloxy)ethyl (Z)-3-(methylamino)but-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate.
| Compound Name | methanamine;2-(2-methylprop-2-enoyloxy)ethyl (Z)-3-(methylamino)but-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate |
|---|---|
| PubChem CID | 158387580 |
| Molecular Formula | C22H36N2O9 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | methanamine;2-(2-methylprop-2-enoyloxy)ethyl (Z)-3-(methylamino)but-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)/C=C(/C)NC.C=C(C)C(=O)OCCOC(=O)CC(C)=O.CN |
| InChI | InChI=1S/C11H17NO4.C10H14O5.CH5N/c1-8(2)11(14)16-6-5-15-10(13)7-9(3)12-4;1-7(2)10(13)15-5-4-14-9(12)6-8(3)11;1-2/h7,12H,1,5-6H2,2-4H3;1,4-6H2,2-3H3;2H2,1H3/b9-7-;; |
| InChIKey | GWNWSCKDABTJPY-COUYFGMESA-N |
| XLogP | 0.98 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|