C10H13LiO5 — CID 121452919
lithium 4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobut-2-en-2-olate (PubChem CID 121452919) has the molecular formula C10H13LiO5 and a molecular weight of 220.15 g/mol. Its IUPAC name is lithium 4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobut-2-en-2-olate.
| Compound Name | lithium 4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobut-2-en-2-olate |
|---|---|
| PubChem CID | 121452919 |
| Molecular Formula | C10H13LiO5 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | lithium 4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobut-2-en-2-olate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C=C(C)[O-].[Li+] |
| InChI | InChI=1S/C10H14O5.Li/c1-7(2)10(13)15-5-4-14-9(12)6-8(3)11;/h6,11H,1,4-5H2,2-3H3;/q;+1/p-1 |
| InChIKey | FCIVVGXHNNXWPF-UHFFFAOYSA-M |
| XLogP | -3.08 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|