About tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate
tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate (PubChem CID 172821251) has the molecular formula C18H36O8
and a molecular weight of 380.48 g/mol. Its IUPAC name is tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate |
| PubChem CID | 172821251 |
| Molecular Formula | C18H36O8 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate |
| SMILES | C=CC(=O)OCCOC(=O)CC(C)=O.CC(C)O.CC(C)O.CC(C)O |
| InChI | InChI=1S/C9H12O5.3C3H8O/c1-3-8(11)13-4-5-14-9(12)6-7(2)10;3*1-3(2)4/h3H,1,4-6H2,2H3;3*3-4H,1-2H3 |
| InChIKey | UGISVCSWDLIJJY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate?
The IUPAC name of tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate (CID 172821251) is tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate.
What is the SMILES notation for tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate?
The canonical SMILES for tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate is C=CC(=O)OCCOC(=O)CC(C)=O.CC(C)O.CC(C)O.CC(C)O.
What is the InChIKey of tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate?
The InChIKey is UGISVCSWDLIJJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5.3C3H8O/c1-3-8(11)13-4-5-14-9(12)6-7(2)10;3*1-3(2)4/h3H,1,4-6H2,2H3;3*3-4H,1-2H3.
What are the key properties of tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate?
tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate has a molecular weight of 380.48 g/mol, XLogP of 1.40, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tris(propan-2-ol);2-prop-2-enoyloxyethyl 3-oxobutanoate is sourced from PubChem (CID 172821251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).