About ethyl 3-oxobutanoate;propan-2-ol
ethyl 3-oxobutanoate;propan-2-ol (PubChem CID 22062382) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is ethyl 3-oxobutanoate;propan-2-ol.
Molecular Properties
| Compound Name | ethyl 3-oxobutanoate;propan-2-ol |
| PubChem CID | 22062382 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | ethyl 3-oxobutanoate;propan-2-ol |
| SMILES | CC(C)O.CCOC(=O)CC(C)=O |
| InChI | InChI=1S/C6H10O3.C3H8O/c1-3-9-6(8)4-5(2)7;1-3(2)4/h3-4H2,1-2H3;3-4H,1-2H3 |
| InChIKey | ZJCRTOGHIZCYDA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxobutanoate;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxobutanoate;propan-2-ol?
The IUPAC name of ethyl 3-oxobutanoate;propan-2-ol (CID 22062382) is ethyl 3-oxobutanoate;propan-2-ol.
What is the SMILES notation for ethyl 3-oxobutanoate;propan-2-ol?
The canonical SMILES for ethyl 3-oxobutanoate;propan-2-ol is CC(C)O.CCOC(=O)CC(C)=O.
What is the InChIKey of ethyl 3-oxobutanoate;propan-2-ol?
The InChIKey is ZJCRTOGHIZCYDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C3H8O/c1-3-9-6(8)4-5(2)7;1-3(2)4/h3-4H2,1-2H3;3-4H,1-2H3.
What are the key properties of ethyl 3-oxobutanoate;propan-2-ol?
ethyl 3-oxobutanoate;propan-2-ol has a molecular weight of 190.24 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxobutanoate;propan-2-ol is sourced from PubChem (CID 22062382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).