About bis(ethyl 3-oxobutanoate);methane
bis(ethyl 3-oxobutanoate);methane (PubChem CID 161351489) has the molecular formula C13H24O6
and a molecular weight of 276.33 g/mol. Its IUPAC name is bis(ethyl 3-oxobutanoate);methane.
Molecular Properties
| Compound Name | bis(ethyl 3-oxobutanoate);methane |
| PubChem CID | 161351489 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | bis(ethyl 3-oxobutanoate);methane |
| SMILES | C.CCOC(=O)CC(C)=O.CCOC(=O)CC(C)=O |
| InChI | InChI=1S/2C6H10O3.CH4/c2*1-3-9-6(8)4-5(2)7;/h2*3-4H2,1-2H3;1H4 |
| InChIKey | VNZHCGLOISQZIK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(ethyl 3-oxobutanoate);methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethyl 3-oxobutanoate);methane?
The IUPAC name of bis(ethyl 3-oxobutanoate);methane (CID 161351489) is bis(ethyl 3-oxobutanoate);methane.
What is the SMILES notation for bis(ethyl 3-oxobutanoate);methane?
The canonical SMILES for bis(ethyl 3-oxobutanoate);methane is C.CCOC(=O)CC(C)=O.CCOC(=O)CC(C)=O.
What is the InChIKey of bis(ethyl 3-oxobutanoate);methane?
The InChIKey is VNZHCGLOISQZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10O3.CH4/c2*1-3-9-6(8)4-5(2)7;/h2*3-4H2,1-2H3;1H4.
What are the key properties of bis(ethyl 3-oxobutanoate);methane?
bis(ethyl 3-oxobutanoate);methane has a molecular weight of 276.33 g/mol, XLogP of 1.69, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethyl 3-oxobutanoate);methane is sourced from PubChem (CID 161351489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).