About ethyl 3-oxobutanoate;nitrous acid
ethyl 3-oxobutanoate;nitrous acid (PubChem CID 174806724) has the molecular formula C6H11NO5
and a molecular weight of 177.16 g/mol. Its IUPAC name is ethyl 3-oxobutanoate;nitrous acid.
Molecular Properties
| Compound Name | ethyl 3-oxobutanoate;nitrous acid |
| PubChem CID | 174806724 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | ethyl 3-oxobutanoate;nitrous acid |
| SMILES | CCOC(=O)CC(C)=O.O=NO |
| InChI | InChI=1S/C6H10O3.HNO2/c1-3-9-6(8)4-5(2)7;2-1-3/h3-4H2,1-2H3;(H,2,3) |
| InChIKey | QZXQDHASGYUMEZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxobutanoate;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxobutanoate;nitrous acid?
The IUPAC name of ethyl 3-oxobutanoate;nitrous acid (CID 174806724) is ethyl 3-oxobutanoate;nitrous acid.
What is the SMILES notation for ethyl 3-oxobutanoate;nitrous acid?
The canonical SMILES for ethyl 3-oxobutanoate;nitrous acid is CCOC(=O)CC(C)=O.O=NO.
What is the InChIKey of ethyl 3-oxobutanoate;nitrous acid?
The InChIKey is QZXQDHASGYUMEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.HNO2/c1-3-9-6(8)4-5(2)7;2-1-3/h3-4H2,1-2H3;(H,2,3).
What are the key properties of ethyl 3-oxobutanoate;nitrous acid?
ethyl 3-oxobutanoate;nitrous acid has a molecular weight of 177.16 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxobutanoate;nitrous acid is sourced from PubChem (CID 174806724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).