About ethyl 3-oxobutanoate;molecular nitrogen
ethyl 3-oxobutanoate;molecular nitrogen (PubChem CID 174817830) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is ethyl 3-oxobutanoate;molecular nitrogen.
Molecular Properties
| Compound Name | ethyl 3-oxobutanoate;molecular nitrogen |
| PubChem CID | 174817830 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | ethyl 3-oxobutanoate;molecular nitrogen |
| SMILES | CCOC(=O)CC(C)=O.N#N |
| InChI | InChI=1S/C6H10O3.N2/c1-3-9-6(8)4-5(2)7;1-2/h3-4H2,1-2H3; |
| InChIKey | OQUFOPFTDGQHMF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxobutanoate;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxobutanoate;molecular nitrogen?
The IUPAC name of ethyl 3-oxobutanoate;molecular nitrogen (CID 174817830) is ethyl 3-oxobutanoate;molecular nitrogen.
What is the SMILES notation for ethyl 3-oxobutanoate;molecular nitrogen?
The canonical SMILES for ethyl 3-oxobutanoate;molecular nitrogen is CCOC(=O)CC(C)=O.N#N.
What is the InChIKey of ethyl 3-oxobutanoate;molecular nitrogen?
The InChIKey is OQUFOPFTDGQHMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.N2/c1-3-9-6(8)4-5(2)7;1-2/h3-4H2,1-2H3;.
What are the key properties of ethyl 3-oxobutanoate;molecular nitrogen?
ethyl 3-oxobutanoate;molecular nitrogen has a molecular weight of 158.16 g/mol, XLogP of 0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxobutanoate;molecular nitrogen is sourced from PubChem (CID 174817830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).