About 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+)
2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+) (PubChem CID 11257663) has the molecular formula C16H34O7Ti+4
and a molecular weight of 386.31 g/mol. Its IUPAC name is 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+).
Molecular Properties
| Compound Name | 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+) |
| PubChem CID | 11257663 |
| Molecular Formula | C16H34O7Ti+4 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+) |
| SMILES | C=CC(=O)OCCOC(C)=O.CC(C)O.CC(C)O.CC(C)O.[Ti+4] |
| InChI | InChI=1S/C7H10O4.3C3H8O.Ti/c1-3-7(9)11-5-4-10-6(2)8;3*1-3(2)4;/h3H,1,4-5H2,2H3;3*3-4H,1-2H3;/q;;;;+4 |
| InChIKey | HTMBBNYVNGBPIB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+)?
The IUPAC name of 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+) (CID 11257663) is 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+).
What is the SMILES notation for 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+)?
The canonical SMILES for 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+) is C=CC(=O)OCCOC(C)=O.CC(C)O.CC(C)O.CC(C)O.[Ti+4].
What is the InChIKey of 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+)?
The InChIKey is HTMBBNYVNGBPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4.3C3H8O.Ti/c1-3-7(9)11-5-4-10-6(2)8;3*1-3(2)4;/h3H,1,4-5H2,2H3;3*3-4H,1-2H3;/q;;;;+4.
What are the key properties of 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+)?
2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+) has a molecular weight of 386.31 g/mol, XLogP of 1.44, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl prop-2-enoate;tris(propan-2-ol);titanium(4+) is sourced from PubChem (CID 11257663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).