About 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate
1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate (PubChem CID 123616376) has the molecular formula C15H22O8
and a molecular weight of 330.33 g/mol. Its IUPAC name is 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate.
Molecular Properties
| Compound Name | 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate |
| PubChem CID | 123616376 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate |
| SMILES | C=CC(=O)OCCCCOC(=O)C(=O)OCCCCOC(C)=O |
| InChI | InChI=1S/C15H22O8/c1-3-13(17)21-9-5-7-11-23-15(19)14(18)22-10-6-4-8-20-12(2)16/h3H,1,4-11H2,2H3 |
| InChIKey | WFGJLNLCMRNTQQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate?
The IUPAC name of 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate (CID 123616376) is 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate.
What is the SMILES notation for 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate?
The canonical SMILES for 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate is C=CC(=O)OCCCCOC(=O)C(=O)OCCCCOC(C)=O.
What is the InChIKey of 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate?
The InChIKey is WFGJLNLCMRNTQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O8/c1-3-13(17)21-9-5-7-11-23-15(19)14(18)22-10-6-4-8-20-12(2)16/h3H,1,4-11H2,2H3.
What are the key properties of 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate?
1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate has a molecular weight of 330.33 g/mol, XLogP of 0.93, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(4-acetyloxybutyl) 2-O-(4-prop-2-enoyloxybutyl) oxalate is sourced from PubChem (CID 123616376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).